C26H24BrN3O4 — CID 176898106
4-[[3-[2-[(4-bromobenzoyl)amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 176898106) has the molecular formula C26H24BrN3O4 and a molecular weight of 522.40 g/mol. Its IUPAC name is 4-[[3-[2-[(4-bromobenzoyl)amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-[2-[(4-bromobenzoyl)amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 176898106 |
| Molecular Formula | C26H24BrN3O4 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 4-[[3-[2-[(4-bromobenzoyl)amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | COc1ccc2c(c1)c(CCNC(=O)c1ccc(Br)cc1)cn2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C26H24BrN3O4/c1-34-22-10-11-24-23(14-22)20(12-13-28-25(31)18-6-8-21(27)9-7-18)16-30(24)15-17-2-4-19(5-3-17)26(32)29-33/h2-11,14,16,33H,12-13,15H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | JSPWBNRQGFKZQA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|