C24H27BrN2O2 — CID 101490756
2-[1-[(4-bromophenyl)methyl]-5-prop-2-enoxyindol-3-yl]-N-butylacetamide (PubChem CID 101490756) has the molecular formula C24H27BrN2O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 2-[1-[(4-bromophenyl)methyl]-5-prop-2-enoxyindol-3-yl]-N-butylacetamide.
| Compound Name | 2-[1-[(4-bromophenyl)methyl]-5-prop-2-enoxyindol-3-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 101490756 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[1-[(4-bromophenyl)methyl]-5-prop-2-enoxyindol-3-yl]-N-butylacetamide |
| SMILES | C=CCOc1ccc2c(c1)c(CC(=O)NCCCC)cn2Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H27BrN2O2/c1-3-5-12-26-24(28)14-19-17-27(16-18-6-8-20(25)9-7-18)23-11-10-21(15-22(19)23)29-13-4-2/h4,6-11,15,17H,2-3,5,12-14,16H2,1H3,(H,26,28) |
| InChIKey | DPBWVFJFHKAWAO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|