About 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide
2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide (PubChem CID 41109158) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide |
| PubChem CID | 41109158 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)Cc1cn(Cc2cc(OC)cc(OC)c2)c2ccccc12 |
| InChI | InChI=1S/C22H26N2O3/c1-4-9-23-22(25)12-17-15-24(21-8-6-5-7-20(17)21)14-16-10-18(26-2)13-19(11-16)27-3/h5-8,10-11,13,15H,4,9,12,14H2,1-3H3,(H,23,25) |
| InChIKey | SQTFNUDSDIDYSL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide?
The IUPAC name of 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide (CID 41109158) is 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide.
What is the SMILES notation for 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide?
The canonical SMILES for 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide is CCCNC(=O)Cc1cn(Cc2cc(OC)cc(OC)c2)c2ccccc12.
What is the InChIKey of 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide?
The InChIKey is SQTFNUDSDIDYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-4-9-23-22(25)12-17-15-24(21-8-6-5-7-20(17)21)14-16-10-18(26-2)13-19(11-16)27-3/h5-8,10-11,13,15H,4,9,12,14H2,1-3H3,(H,23,25).
What are the key properties of 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide?
2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide has a molecular weight of 366.46 g/mol, XLogP of 3.78, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]-N-propylacetamide is sourced from PubChem (CID 41109158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).