C26H32N2O3 — CID 41109175
N-cycloheptyl-2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]acetamide (PubChem CID 41109175) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-cycloheptyl-2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]acetamide.
| Compound Name | N-cycloheptyl-2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 41109175 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-cycloheptyl-2-[1-[(3,5-dimethoxyphenyl)methyl]indol-3-yl]acetamide |
| SMILES | COc1cc(Cn2cc(CC(=O)NC3CCCCCC3)c3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C26H32N2O3/c1-30-22-13-19(14-23(16-22)31-2)17-28-18-20(24-11-7-8-12-25(24)28)15-26(29)27-21-9-5-3-4-6-10-21/h7-8,11-14,16,18,21H,3-6,9-10,15,17H2,1-2H3,(H,27,29) |
| InChIKey | WINSBJBCJHNNAU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |