C27H34N2O — CID 20900075
N-cycloheptyl-3-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]propanamide (PubChem CID 20900075) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is N-cycloheptyl-3-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]propanamide.
| Compound Name | N-cycloheptyl-3-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]propanamide |
|---|---|
| PubChem CID | 20900075 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | N-cycloheptyl-3-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]propanamide |
| SMILES | Cc1ccc(C)c(Cn2cc(CCC(=O)NC3CCCCCC3)c3ccccc32)c1 |
| InChI | InChI=1S/C27H34N2O/c1-20-13-14-21(2)23(17-20)19-29-18-22(25-11-7-8-12-26(25)29)15-16-27(30)28-24-9-5-3-4-6-10-24/h7-8,11-14,17-18,24H,3-6,9-10,15-16,19H2,1-2H3,(H,28,30) |
| InChIKey | VYTJSXGREWZQFD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |