C30H30ClNO5 — CID 142737126
methyl 2-[5-[3-[3-[(4-chlorophenyl)methoxy]phenoxy]propoxy]-1-prop-2-enylindol-3-yl]acetate (PubChem CID 142737126) has the molecular formula C30H30ClNO5 and a molecular weight of 520.03 g/mol. Its IUPAC name is methyl 2-[5-[3-[3-[(4-chlorophenyl)methoxy]phenoxy]propoxy]-1-prop-2-enylindol-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-[3-[(4-chlorophenyl)methoxy]phenoxy]propoxy]-1-prop-2-enylindol-3-yl]acetate |
|---|---|
| PubChem CID | 142737126 |
| Molecular Formula | C30H30ClNO5 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | methyl 2-[5-[3-[3-[(4-chlorophenyl)methoxy]phenoxy]propoxy]-1-prop-2-enylindol-3-yl]acetate |
| SMILES | C=CCn1cc(CC(=O)OC)c2cc(OCCCOc3cccc(OCc4ccc(Cl)cc4)c3)ccc21 |
| InChI | InChI=1S/C30H30ClNO5/c1-3-14-32-20-23(17-30(33)34-2)28-19-27(12-13-29(28)32)36-16-5-15-35-25-6-4-7-26(18-25)37-21-22-8-10-24(31)11-9-22/h3-4,6-13,18-20H,1,5,14-17,21H2,2H3 |
| InChIKey | NVYKEEXIQRNKFS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|