C24H17Cl2FN2O3 — CID 110167918
N-(2,6-dichlorophenyl)-2-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxoacetamide (PubChem CID 110167918) has the molecular formula C24H17Cl2FN2O3 and a molecular weight of 471.32 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxoacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 110167918 |
| Molecular Formula | C24H17Cl2FN2O3 |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxoacetamide |
| SMILES | COc1ccc2c(c1)c(C(=O)C(=O)Nc1c(Cl)cccc1Cl)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Cl2FN2O3/c1-32-16-9-10-21-17(11-16)18(13-29(21)12-14-5-7-15(27)8-6-14)23(30)24(31)28-22-19(25)3-2-4-20(22)26/h2-11,13H,12H2,1H3,(H,28,31) |
| InChIKey | NDWBFZGGWFEIDF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|