C23H18FNO3 — CID 21079394
1-[(4-fluorophenyl)methyl]-4-phenylmethoxyindole-3-carboxylic acid (PubChem CID 21079394) has the molecular formula C23H18FNO3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-phenylmethoxyindole-3-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-phenylmethoxyindole-3-carboxylic acid |
|---|---|
| PubChem CID | 21079394 |
| Molecular Formula | C23H18FNO3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-phenylmethoxyindole-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(F)cc2)c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C23H18FNO3/c24-18-11-9-16(10-12-18)13-25-14-19(23(26)27)22-20(25)7-4-8-21(22)28-15-17-5-2-1-3-6-17/h1-12,14H,13,15H2,(H,26,27) |
| InChIKey | IBNVAKKSLGBYRW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |