C27H26N2O4 — CID 10503348
1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindole-3-carboxylic acid (PubChem CID 10503348) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindole-3-carboxylic acid.
| Compound Name | 1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindole-3-carboxylic acid |
|---|---|
| PubChem CID | 10503348 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindole-3-carboxylic acid |
| SMILES | CN(CCc1ccccc1)C(=O)Cn1cc(C(=O)O)c2c(OCc3ccccc3)cccc21 |
| InChI | InChI=1S/C27H26N2O4/c1-28(16-15-20-9-4-2-5-10-20)25(30)18-29-17-22(27(31)32)26-23(29)13-8-14-24(26)33-19-21-11-6-3-7-12-21/h2-14,17H,15-16,18-19H2,1H3,(H,31,32) |
| InChIKey | PWCPJKIYPSJPPM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |