C27H26N2O3 — CID 10741107
2-(3-formyl-4-phenylmethoxyindol-1-yl)-N-methyl-N-(2-phenylethyl)acetamide (PubChem CID 10741107) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(3-formyl-4-phenylmethoxyindol-1-yl)-N-methyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(3-formyl-4-phenylmethoxyindol-1-yl)-N-methyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 10741107 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(3-formyl-4-phenylmethoxyindol-1-yl)-N-methyl-N-(2-phenylethyl)acetamide |
| SMILES | CN(CCc1ccccc1)C(=O)Cn1cc(C=O)c2c(OCc3ccccc3)cccc21 |
| InChI | InChI=1S/C27H26N2O3/c1-28(16-15-21-9-4-2-5-10-21)26(31)18-29-17-23(19-30)27-24(29)13-8-14-25(27)32-20-22-11-6-3-7-12-22/h2-14,17,19H,15-16,18,20H2,1H3 |
| InChIKey | ZYNRDTBRGYLTLA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|