C28H28N2O4 — CID 11798055
2-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]acetic acid (PubChem CID 11798055) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]acetic acid.
| Compound Name | 2-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 11798055 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]acetic acid |
| SMILES | CN(CCc1ccccc1)C(=O)Cn1cc(CC(=O)O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C28H28N2O4/c1-29(15-14-21-8-4-2-5-9-21)27(31)19-30-18-23(16-28(32)33)25-17-24(12-13-26(25)30)34-20-22-10-6-3-7-11-22/h2-13,17-18H,14-16,19-20H2,1H3,(H,32,33) |
| InChIKey | ZOTJAVXQUIZQEQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |