C32H34N2O4 — CID 19372330
ethyl (Z)-2-methyl-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]prop-2-enoate (PubChem CID 19372330) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is ethyl (Z)-2-methyl-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-methyl-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 19372330 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | ethyl (Z)-2-methyl-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\c1cn(CC(=O)N(C)CCc2ccccc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C32H34N2O4/c1-4-37-32(36)24(2)19-27-21-34(22-31(35)33(3)18-17-25-11-7-5-8-12-25)30-16-15-28(20-29(27)30)38-23-26-13-9-6-10-14-26/h5-16,19-21H,4,17-18,22-23H2,1-3H3/b24-19- |
| InChIKey | YUVYCTDNDHEIOK-CLCOLTQESA-N |
| XLogP | 5.89 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|