C28H26FN3O4 — CID 142706808
2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid (PubChem CID 142706808) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 142706808 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2ccc(F)cc2)c2ccc(OCCCNCc3nc4ccccc4o3)cc12 |
| InChI | InChI=1S/C28H26FN3O4/c29-21-8-6-19(7-9-21)17-32-18-20(14-28(33)34)23-15-22(10-11-25(23)32)35-13-3-12-30-16-27-31-24-4-1-2-5-26(24)36-27/h1-2,4-11,15,18,30H,3,12-14,16-17H2,(H,33,34) |
| InChIKey | VHZPWYTZCXIFQF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|