C29H28FN3O4 — CID 142706814
methyl 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate (PubChem CID 142706814) has the molecular formula C29H28FN3O4 and a molecular weight of 501.56 g/mol. Its IUPAC name is methyl 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 142706814 |
| Molecular Formula | C29H28FN3O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | methyl 2-[5-[3-(1,3-benzoxazol-2-ylmethylamino)propoxy]-1-[(4-fluorophenyl)methyl]indol-3-yl]acetate |
| SMILES | COC(=O)Cc1cn(Cc2ccc(F)cc2)c2ccc(OCCCNCc3nc4ccccc4o3)cc12 |
| InChI | InChI=1S/C29H28FN3O4/c1-35-29(34)15-21-19-33(18-20-7-9-22(30)10-8-20)26-12-11-23(16-24(21)26)36-14-4-13-31-17-28-32-25-5-2-3-6-27(25)37-28/h2-3,5-12,16,19,31H,4,13-15,17-18H2,1H3 |
| InChIKey | BBKSFYLGCZOPHZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|