C27H27NO5 — CID 122183544
2-[6-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetic acid (PubChem CID 122183544) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[6-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[6-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 122183544 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[6-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(COc2cccc(OCCCOc3ccc4c(CC(=O)O)c[nH]c4c3)c2)cc1 |
| InChI | InChI=1S/C27H27NO5/c1-19-6-8-20(9-7-19)18-33-23-5-2-4-22(15-23)31-12-3-13-32-24-10-11-25-21(14-27(29)30)17-28-26(25)16-24/h2,4-11,15-17,28H,3,12-14,18H2,1H3,(H,29,30) |
| InChIKey | WONKYBRJOJOBPU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|