C24H25ClN2O3 — CID 41108918
methyl 1-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperidine-4-carboxylate (PubChem CID 41108918) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is methyl 1-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 41108918 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | methyl 1-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)Cc2cn(Cc3ccc(Cl)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-30-24(29)18-10-12-26(13-11-18)23(28)14-19-16-27(22-5-3-2-4-21(19)22)15-17-6-8-20(25)9-7-17/h2-9,16,18H,10-15H2,1H3 |
| InChIKey | HKZBOGZDYTZGJV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |