C19H16F3NO2 — CID 68956846
2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid (PubChem CID 68956846) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68956846 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2ccccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3NO2/c1-12-16(10-18(24)25)15-7-2-3-8-17(15)23(12)11-13-5-4-6-14(9-13)19(20,21)22/h2-9H,10-11H2,1H3,(H,24,25) |
| InChIKey | YQKIXRWOXNVLAV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|