C19H12F3NO2 — CID 167092328
3-ethynyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 167092328) has the molecular formula C19H12F3NO2 and a molecular weight of 343.30 g/mol. Its IUPAC name is 3-ethynyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-ethynyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 167092328 |
| Molecular Formula | C19H12F3NO2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 3-ethynyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | C#Cc1c(C(=O)O)n(Cc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C19H12F3NO2/c1-2-14-15-8-3-4-9-16(15)23(17(14)18(24)25)11-12-6-5-7-13(10-12)19(20,21)22/h1,3-10H,11H2,(H,24,25) |
| InChIKey | OOELHENPFFZATM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|