C21H14ClF3N2O — CID 174414627
8-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 174414627) has the molecular formula C21H14ClF3N2O and a molecular weight of 402.80 g/mol. Its IUPAC name is 8-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 8-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414627 |
| Molecular Formula | C21H14ClF3N2O |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 8-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cccc(Cl)c1n2Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14ClF3N2O/c22-16-8-2-6-14-18-15(20(26)28)7-3-9-17(18)27(19(14)16)11-12-4-1-5-13(10-12)21(23,24)25/h1-10H,11H2,(H2,26,28) |
| InChIKey | NEAWSDLQCFOWGW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |