C23H19F3N2O2 — CID 22738225
7-ethyl-5-hydroxy-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 22738225) has the molecular formula C23H19F3N2O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is 7-ethyl-5-hydroxy-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 7-ethyl-5-hydroxy-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 22738225 |
| Molecular Formula | C23H19F3N2O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 7-ethyl-5-hydroxy-9-[[3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | CCc1cc(O)c2c3c(C(N)=O)cccc3n(Cc3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C23H19F3N2O2/c1-2-13-10-18-21(19(29)11-13)20-16(22(27)30)7-4-8-17(20)28(18)12-14-5-3-6-15(9-14)23(24,25)26/h3-11,29H,2,12H2,1H3,(H2,27,30) |
| InChIKey | UUQHLSRAOVICGH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |