C22H19FN2O2 — CID 22738776
7-ethyl-9-[(3-fluorophenyl)methyl]-5-hydroxycarbazole-4-carboxamide (PubChem CID 22738776) has the molecular formula C22H19FN2O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is 7-ethyl-9-[(3-fluorophenyl)methyl]-5-hydroxycarbazole-4-carboxamide.
| Compound Name | 7-ethyl-9-[(3-fluorophenyl)methyl]-5-hydroxycarbazole-4-carboxamide |
|---|---|
| PubChem CID | 22738776 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 7-ethyl-9-[(3-fluorophenyl)methyl]-5-hydroxycarbazole-4-carboxamide |
| SMILES | CCc1cc(O)c2c3c(C(N)=O)cccc3n(Cc3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C22H19FN2O2/c1-2-13-10-18-21(19(26)11-13)20-16(22(24)27)7-4-8-17(20)25(18)12-14-5-3-6-15(23)9-14/h3-11,26H,2,12H2,1H3,(H2,24,27) |
| InChIKey | DNROZEIAMBKHTB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |