C22H20N2O2 — CID 22739095
9-[(3,5-dimethylphenyl)methyl]-5-hydroxycarbazole-4-carboxamide (PubChem CID 22739095) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 9-[(3,5-dimethylphenyl)methyl]-5-hydroxycarbazole-4-carboxamide.
| Compound Name | 9-[(3,5-dimethylphenyl)methyl]-5-hydroxycarbazole-4-carboxamide |
|---|---|
| PubChem CID | 22739095 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 9-[(3,5-dimethylphenyl)methyl]-5-hydroxycarbazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(Cn2c3cccc(O)c3c3c(C(N)=O)cccc32)c1 |
| InChI | InChI=1S/C22H20N2O2/c1-13-9-14(2)11-15(10-13)12-24-17-6-3-5-16(22(23)26)20(17)21-18(24)7-4-8-19(21)25/h3-11,25H,12H2,1-2H3,(H2,23,26) |
| InChIKey | XCPQDLGZHDLIOI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |