C27H22N2O — CID 174424042
9-[(4-methylphenyl)methyl]-7-phenylcarbazole-4-carboxamide (PubChem CID 174424042) has the molecular formula C27H22N2O and a molecular weight of 390.49 g/mol. Its IUPAC name is 9-[(4-methylphenyl)methyl]-7-phenylcarbazole-4-carboxamide.
| Compound Name | 9-[(4-methylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174424042 |
| Molecular Formula | C27H22N2O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 9-[(4-methylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2c3cc(-c4ccccc4)ccc3c3c(C(N)=O)cccc32)cc1 |
| InChI | InChI=1S/C27H22N2O/c1-18-10-12-19(13-11-18)17-29-24-9-5-8-23(27(28)30)26(24)22-15-14-21(16-25(22)29)20-6-3-2-4-7-20/h2-16H,17H2,1H3,(H2,28,30) |
| InChIKey | QZRMLWUCDBNKBO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |