C28H22N2O3 — CID 174417858
9-[(4-benzoylphenyl)methyl]-7-(hydroxymethyl)carbazole-4-carboxamide (PubChem CID 174417858) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 9-[(4-benzoylphenyl)methyl]-7-(hydroxymethyl)carbazole-4-carboxamide.
| Compound Name | 9-[(4-benzoylphenyl)methyl]-7-(hydroxymethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417858 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 9-[(4-benzoylphenyl)methyl]-7-(hydroxymethyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(CO)cc1n2Cc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2O3/c29-28(33)23-7-4-8-24-26(23)22-14-11-19(17-31)15-25(22)30(24)16-18-9-12-21(13-10-18)27(32)20-5-2-1-3-6-20/h1-15,31H,16-17H2,(H2,29,33) |
| InChIKey | XZCZMWJZDWXAHS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |