C21H17IN2O2 — CID 174417942
7-(hydroxymethyl)-9-[(3-iodophenyl)methyl]carbazole-4-carboxamide (PubChem CID 174417942) has the molecular formula C21H17IN2O2 and a molecular weight of 456.28 g/mol. Its IUPAC name is 7-(hydroxymethyl)-9-[(3-iodophenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 7-(hydroxymethyl)-9-[(3-iodophenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417942 |
| Molecular Formula | C21H17IN2O2 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 7-(hydroxymethyl)-9-[(3-iodophenyl)methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(CO)cc1n2Cc1cccc(I)c1 |
| InChI | InChI=1S/C21H17IN2O2/c22-15-4-1-3-13(9-15)11-24-18-6-2-5-17(21(23)26)20(18)16-8-7-14(12-25)10-19(16)24/h1-10,25H,11-12H2,(H2,23,26) |
| InChIKey | LHCRVDMSDFIUOV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|