C22H18Cl2N2O — CID 174400697
9-[(3,5-dichlorophenyl)methyl]-7-ethylcarbazole-4-carboxamide (PubChem CID 174400697) has the molecular formula C22H18Cl2N2O and a molecular weight of 397.31 g/mol. Its IUPAC name is 9-[(3,5-dichlorophenyl)methyl]-7-ethylcarbazole-4-carboxamide.
| Compound Name | 9-[(3,5-dichlorophenyl)methyl]-7-ethylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400697 |
| Molecular Formula | C22H18Cl2N2O |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 9-[(3,5-dichlorophenyl)methyl]-7-ethylcarbazole-4-carboxamide |
| SMILES | CCc1ccc2c3c(C(N)=O)cccc3n(Cc3cc(Cl)cc(Cl)c3)c2c1 |
| InChI | InChI=1S/C22H18Cl2N2O/c1-2-13-6-7-17-20(10-13)26(12-14-8-15(23)11-16(24)9-14)19-5-3-4-18(21(17)19)22(25)27/h3-11H,2,12H2,1H3,(H2,25,27) |
| InChIKey | UTUCQSPODILXLE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |