C23H18F4N2O — CID 174414795
7-ethyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 174414795) has the molecular formula C23H18F4N2O and a molecular weight of 414.40 g/mol. Its IUPAC name is 7-ethyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 7-ethyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414795 |
| Molecular Formula | C23H18F4N2O |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 7-ethyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | CCc1ccc2c3c(C(N)=O)cccc3n(Cc3ccc(F)c(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C23H18F4N2O/c1-2-13-6-8-15-20(11-13)29(19-5-3-4-16(21(15)19)22(28)30)12-14-7-9-18(24)17(10-14)23(25,26)27/h3-11H,2,12H2,1H3,(H2,28,30) |
| InChIKey | AGUDGACLRBNBLJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |