C26H24F4N2O — CID 174401347
9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-pentylcarbazole-4-carboxamide (PubChem CID 174401347) has the molecular formula C26H24F4N2O and a molecular weight of 456.48 g/mol. Its IUPAC name is 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-pentylcarbazole-4-carboxamide.
| Compound Name | 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-pentylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401347 |
| Molecular Formula | C26H24F4N2O |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-pentylcarbazole-4-carboxamide |
| SMILES | CCCCCc1ccc2c3c(C(N)=O)cccc3n(Cc3cc(C(F)(F)F)ccc3F)c2c1 |
| InChI | InChI=1S/C26H24F4N2O/c1-2-3-4-6-16-9-11-19-23(13-16)32(22-8-5-7-20(24(19)22)25(31)33)15-17-14-18(26(28,29)30)10-12-21(17)27/h5,7-14H,2-4,6,15H2,1H3,(H2,31,33) |
| InChIKey | MODJWUXLTPIMTR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|