C21H13F5N2O — CID 175235633
8-fluoro-9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 175235633) has the molecular formula C21H13F5N2O and a molecular weight of 404.34 g/mol. Its IUPAC name is 8-fluoro-9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 8-fluoro-9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 175235633 |
| Molecular Formula | C21H13F5N2O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 8-fluoro-9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cccc(F)c1n2Cc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C21H13F5N2O/c22-15-8-7-12(21(24,25)26)9-11(15)10-28-17-6-2-4-14(20(27)29)18(17)13-3-1-5-16(23)19(13)28/h1-9H,10H2,(H2,27,29) |
| InChIKey | TVRSDOOPEHWEPI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |