C20H13ClF2N2O — CID 174417772
9-[(3-chloro-2-fluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide (PubChem CID 174417772) has the molecular formula C20H13ClF2N2O and a molecular weight of 370.79 g/mol. Its IUPAC name is 9-[(3-chloro-2-fluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide.
| Compound Name | 9-[(3-chloro-2-fluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417772 |
| Molecular Formula | C20H13ClF2N2O |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 9-[(3-chloro-2-fluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cccc(F)c1n2Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C20H13ClF2N2O/c21-14-7-1-4-11(18(14)23)10-25-16-9-3-6-13(20(24)26)17(16)12-5-2-8-15(22)19(12)25/h1-9H,10H2,(H2,24,26) |
| InChIKey | LGLUERVWBRQYJL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |