C26H17Cl2FN2O — CID 174400395
9-[(2-chloro-6-fluorophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide (PubChem CID 174400395) has the molecular formula C26H17Cl2FN2O and a molecular weight of 463.34 g/mol. Its IUPAC name is 9-[(2-chloro-6-fluorophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(2-chloro-6-fluorophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400395 |
| Molecular Formula | C26H17Cl2FN2O |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 9-[(2-chloro-6-fluorophenyl)methyl]-7-(4-chlorophenyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccc(Cl)cc3)cc1n2Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C26H17Cl2FN2O/c27-17-10-7-15(8-11-17)16-9-12-18-24(13-16)31(14-20-21(28)4-2-5-22(20)29)23-6-1-3-19(25(18)23)26(30)32/h1-13H,14H2,(H2,30,32) |
| InChIKey | JRLRNYJJSFYKMK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |