C22H18ClFN2O2 — CID 174400045
9-[(2-chloro-6-fluorophenyl)methyl]-7-(methoxymethyl)carbazole-4-carboxamide (PubChem CID 174400045) has the molecular formula C22H18ClFN2O2 and a molecular weight of 396.85 g/mol. Its IUPAC name is 9-[(2-chloro-6-fluorophenyl)methyl]-7-(methoxymethyl)carbazole-4-carboxamide.
| Compound Name | 9-[(2-chloro-6-fluorophenyl)methyl]-7-(methoxymethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400045 |
| Molecular Formula | C22H18ClFN2O2 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 9-[(2-chloro-6-fluorophenyl)methyl]-7-(methoxymethyl)carbazole-4-carboxamide |
| SMILES | COCc1ccc2c3c(C(N)=O)cccc3n(Cc3c(F)cccc3Cl)c2c1 |
| InChI | InChI=1S/C22H18ClFN2O2/c1-28-12-13-8-9-14-20(10-13)26(11-16-17(23)5-3-6-18(16)24)19-7-2-4-15(21(14)19)22(25)27/h2-10H,11-12H2,1H3,(H2,25,27) |
| InChIKey | HXODKOUCNUOGQQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |