C24H16Cl2N2O2 — CID 174440701
9-[(2,6-dichlorophenyl)methyl]-7-(furan-2-yl)carbazole-4-carboxamide (PubChem CID 174440701) has the molecular formula C24H16Cl2N2O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-7-(furan-2-yl)carbazole-4-carboxamide.
| Compound Name | 9-[(2,6-dichlorophenyl)methyl]-7-(furan-2-yl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174440701 |
| Molecular Formula | C24H16Cl2N2O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-7-(furan-2-yl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccco3)cc1n2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H16Cl2N2O2/c25-18-5-2-6-19(26)17(18)13-28-20-7-1-4-16(24(27)29)23(20)15-10-9-14(12-21(15)28)22-8-3-11-30-22/h1-12H,13H2,(H2,27,29) |
| InChIKey | IRJPVASBDHRCMM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |