C25H16F4N2O2 — CID 174399783
9-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7-(furan-2-yl)carbazole-4-carboxamide (PubChem CID 174399783) has the molecular formula C25H16F4N2O2 and a molecular weight of 452.41 g/mol. Its IUPAC name is 9-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7-(furan-2-yl)carbazole-4-carboxamide.
| Compound Name | 9-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7-(furan-2-yl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174399783 |
| Molecular Formula | C25H16F4N2O2 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 9-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7-(furan-2-yl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccco3)cc1n2Cc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C25H16F4N2O2/c26-19-12-16(25(27,28)29)8-6-15(19)13-31-20-4-1-3-18(24(30)32)23(20)17-9-7-14(11-21(17)31)22-5-2-10-33-22/h1-12H,13H2,(H2,30,32) |
| InChIKey | JVWAGNCJKSTUSD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |