C27H18F4N2O — CID 174401684
9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-phenylcarbazole-4-carboxamide (PubChem CID 174401684) has the molecular formula C27H18F4N2O and a molecular weight of 462.45 g/mol. Its IUPAC name is 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-phenylcarbazole-4-carboxamide.
| Compound Name | 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-phenylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401684 |
| Molecular Formula | C27H18F4N2O |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 9-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-7-phenylcarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(-c3ccccc3)cc1n2Cc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C27H18F4N2O/c28-22-12-10-19(27(29,30)31)13-18(22)15-33-23-8-4-7-21(26(32)34)25(23)20-11-9-17(14-24(20)33)16-5-2-1-3-6-16/h1-14H,15H2,(H2,32,34) |
| InChIKey | BJDVDOLLBVPVNX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |