About 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide
9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide (PubChem CID 175233547) has the molecular formula C27H20Cl2N2O2
and a molecular weight of 475.40 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide.
Molecular Properties
| Compound Name | 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
| PubChem CID | 175233547 |
| Molecular Formula | C27H20Cl2N2O2 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(C=C2)C4=C(C=CC=C4N3CC5=C(C=CC=C5Cl)Cl)C(=O)N |
| InChI | InChI=1S/C27H20Cl2N2O2/c1-33-18-11-8-16(9-12-18)17-10-13-19-25(14-17)31(15-21-22(28)5-3-6-23(21)29)24-7-2-4-20(26(19)24)27(30)32/h2-14H,15H2,1H3,(H2,30,32) |
| InChIKey | JZWQQLGCTOBKOQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 57.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | 675 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide?
The IUPAC name of 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide (CID 175233547) is 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide.
What is the SMILES notation for 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide?
The canonical SMILES for 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide is COC1=CC=C(C=C1)C2=CC3=C(C=C2)C4=C(C=CC=C4N3CC5=C(C=CC=C5Cl)Cl)C(=O)N.
What is the InChIKey of 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide?
The InChIKey is JZWQQLGCTOBKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20Cl2N2O2/c1-33-18-11-8-16(9-12-18)17-10-13-19-25(14-17)31(15-21-22(28)5-3-6-23(21)29)24-7-2-4-20(26(19)24)27(30)32/h2-14H,15H2,1H3,(H2,30,32).
What are the key properties of 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide?
9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide has a molecular weight of 475.40 g/mol, XLogP of 6.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-Dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide is sourced from PubChem (CID 175233547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).