C27H20Cl2N2O2 — CID 175233547
9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide (PubChem CID 175233547) has the molecular formula C27H20Cl2N2O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 175233547 |
| Molecular Formula | C27H20Cl2N2O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
| SMILES | COc1ccc(-c2ccc3c4c(C(N)=O)cccc4n(Cc4c(Cl)cccc4Cl)c3c2)cc1 |
| InChI | InChI=1S/C27H20Cl2N2O2/c1-33-18-11-8-16(9-12-18)17-10-13-19-25(14-17)31(15-21-22(28)5-3-6-23(21)29)24-7-2-4-20(26(19)24)27(30)32/h2-14H,15H2,1H3,(H2,30,32) |
| InChIKey | JZWQQLGCTOBKOQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |