C27H21BrN2O2 — CID 174414385
9-[(2-bromophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide (PubChem CID 174414385) has the molecular formula C27H21BrN2O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 9-[(2-bromophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(2-bromophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414385 |
| Molecular Formula | C27H21BrN2O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 9-[(2-bromophenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
| SMILES | COc1ccc(-c2ccc3c4c(C(N)=O)cccc4n(Cc4ccccc4Br)c3c2)cc1 |
| InChI | InChI=1S/C27H21BrN2O2/c1-32-20-12-9-17(10-13-20)18-11-14-21-25(15-18)30(16-19-5-2-3-7-23(19)28)24-8-4-6-22(26(21)24)27(29)31/h2-15H,16H2,1H3,(H2,29,31) |
| InChIKey | GOPKYMYKBKTMPL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |