C28H24N2O — CID 175235829
9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide (PubChem CID 175235829) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide.
| Compound Name | 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 175235829 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2c3cc(-c4ccccc4)ccc3c3c(C(N)=O)cccc32)c(C)c1 |
| InChI | InChI=1S/C28H24N2O/c1-18-11-12-22(19(2)15-18)17-30-25-10-6-9-24(28(29)31)27(25)23-14-13-21(16-26(23)30)20-7-4-3-5-8-20/h3-16H,17H2,1-2H3,(H2,29,31) |
| InChIKey | FYNZIRCOZLZXBV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |