About 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide
9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide (PubChem CID 175235829) has the molecular formula C28H24N2O
and a molecular weight of 404.51 g/mol. Its IUPAC name is 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide.
Molecular Properties
| Compound Name | 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
| PubChem CID | 175235829 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2c3cc(-c4ccccc4)ccc3c3c(C(N)=O)cccc32)c(C)c1 |
| InChI | InChI=1S/C28H24N2O/c1-18-11-12-22(19(2)15-18)17-30-25-10-6-9-24(28(29)31)27(25)23-14-13-21(16-26(23)30)20-7-4-3-5-8-20/h3-16H,17H2,1-2H3,(H2,29,31) |
| InChIKey | FYNZIRCOZLZXBV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide?
The IUPAC name of 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide (CID 175235829) is 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide.
What is the SMILES notation for 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide?
The canonical SMILES for 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide is Cc1ccc(Cn2c3cc(-c4ccccc4)ccc3c3c(C(N)=O)cccc32)c(C)c1.
What is the InChIKey of 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide?
The InChIKey is FYNZIRCOZLZXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2O/c1-18-11-12-22(19(2)15-18)17-30-25-10-6-9-24(28(29)31)27(25)23-14-13-21(16-26(23)30)20-7-4-3-5-8-20/h3-16H,17H2,1-2H3,(H2,29,31).
What are the key properties of 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide?
9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide has a molecular weight of 404.51 g/mol, XLogP of 6.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,4-dimethylphenyl)methyl]-7-phenylcarbazole-4-carboxamide is sourced from PubChem (CID 175235829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).