C27H30N2O — CID 174414828
9-[(2,4-dimethylphenyl)methyl]-7-pentylcarbazole-4-carboxamide (PubChem CID 174414828) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is 9-[(2,4-dimethylphenyl)methyl]-7-pentylcarbazole-4-carboxamide.
| Compound Name | 9-[(2,4-dimethylphenyl)methyl]-7-pentylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414828 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 9-[(2,4-dimethylphenyl)methyl]-7-pentylcarbazole-4-carboxamide |
| SMILES | CCCCCc1ccc2c3c(C(N)=O)cccc3n(Cc3ccc(C)cc3C)c2c1 |
| InChI | InChI=1S/C27H30N2O/c1-4-5-6-8-20-12-14-22-25(16-20)29(17-21-13-11-18(2)15-19(21)3)24-10-7-9-23(26(22)24)27(28)30/h7,9-16H,4-6,8,17H2,1-3H3,(H2,28,30) |
| InChIKey | CVVZDZWURYSPOL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|