C26H28N2O3S — CID 174417959
9-[(4-methylsulfonylphenyl)methyl]-7-pentylcarbazole-4-carboxamide (PubChem CID 174417959) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 9-[(4-methylsulfonylphenyl)methyl]-7-pentylcarbazole-4-carboxamide.
| Compound Name | 9-[(4-methylsulfonylphenyl)methyl]-7-pentylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417959 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 9-[(4-methylsulfonylphenyl)methyl]-7-pentylcarbazole-4-carboxamide |
| SMILES | CCCCCc1ccc2c3c(C(N)=O)cccc3n(Cc3ccc(S(C)(=O)=O)cc3)c2c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-3-4-5-7-18-12-15-21-24(16-18)28(23-9-6-8-22(25(21)23)26(27)29)17-19-10-13-20(14-11-19)32(2,30)31/h6,8-16H,3-5,7,17H2,1-2H3,(H2,27,29) |
| InChIKey | MYGSUEWZMGGWLZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|