C21H20N2OS — CID 174401378
7-propyl-9-(thiophen-3-ylmethyl)carbazole-4-carboxamide (PubChem CID 174401378) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 7-propyl-9-(thiophen-3-ylmethyl)carbazole-4-carboxamide.
| Compound Name | 7-propyl-9-(thiophen-3-ylmethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174401378 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 7-propyl-9-(thiophen-3-ylmethyl)carbazole-4-carboxamide |
| SMILES | CCCc1ccc2c3c(C(N)=O)cccc3n(Cc3ccsc3)c2c1 |
| InChI | InChI=1S/C21H20N2OS/c1-2-4-14-7-8-16-19(11-14)23(12-15-9-10-25-13-15)18-6-3-5-17(20(16)18)21(22)24/h3,5-11,13H,2,4,12H2,1H3,(H2,22,24) |
| InChIKey | KBHXXPZDTIVNDB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |