C24H21N3O — CID 175235910
9-[(2-cyanophenyl)methyl]-7-propylcarbazole-4-carboxamide (PubChem CID 175235910) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 9-[(2-cyanophenyl)methyl]-7-propylcarbazole-4-carboxamide.
| Compound Name | 9-[(2-cyanophenyl)methyl]-7-propylcarbazole-4-carboxamide |
|---|---|
| PubChem CID | 175235910 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 9-[(2-cyanophenyl)methyl]-7-propylcarbazole-4-carboxamide |
| SMILES | CCCc1ccc2c3c(C(N)=O)cccc3n(Cc3ccccc3C#N)c2c1 |
| InChI | InChI=1S/C24H21N3O/c1-2-6-16-11-12-19-22(13-16)27(15-18-8-4-3-7-17(18)14-25)21-10-5-9-20(23(19)21)24(26)28/h3-5,7-13H,2,6,15H2,1H3,(H2,26,28) |
| InChIKey | IZXMHCYUUXJFBY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |