C25H24F2N2O2 — CID 174400322
7-butyl-9-[[3-(difluoromethoxy)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 174400322) has the molecular formula C25H24F2N2O2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 7-butyl-9-[[3-(difluoromethoxy)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 7-butyl-9-[[3-(difluoromethoxy)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400322 |
| Molecular Formula | C25H24F2N2O2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 7-butyl-9-[[3-(difluoromethoxy)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | CCCCc1ccc2c3c(C(N)=O)cccc3n(Cc3cccc(OC(F)F)c3)c2c1 |
| InChI | InChI=1S/C25H24F2N2O2/c1-2-3-6-16-11-12-19-22(14-16)29(21-10-5-9-20(23(19)21)24(28)30)15-17-7-4-8-18(13-17)31-25(26)27/h4-5,7-14,25H,2-3,6,15H2,1H3,(H2,28,30) |
| InChIKey | VHFGGWGVYXXNIS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |