C22H15F5N2O2 — CID 175235591
9-[[4-(difluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)carbazole-4-carboxamide (PubChem CID 175235591) has the molecular formula C22H15F5N2O2 and a molecular weight of 434.36 g/mol. Its IUPAC name is 9-[[4-(difluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)carbazole-4-carboxamide.
| Compound Name | 9-[[4-(difluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 175235591 |
| Molecular Formula | C22H15F5N2O2 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 9-[[4-(difluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1ccc(C(F)(F)F)cc1n2Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H15F5N2O2/c23-21(24)31-14-7-4-12(5-8-14)11-29-17-3-1-2-16(20(28)30)19(17)15-9-6-13(10-18(15)29)22(25,26)27/h1-10,21H,11H2,(H2,28,30) |
| InChIKey | JZXPVEGZSKCTPH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |