C28H23N3O3 — CID 174400022
9-[(4-carbamoylphenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide (PubChem CID 174400022) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 9-[(4-carbamoylphenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide.
| Compound Name | 9-[(4-carbamoylphenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174400022 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 9-[(4-carbamoylphenyl)methyl]-7-(4-methoxyphenyl)carbazole-4-carboxamide |
| SMILES | COc1ccc(-c2ccc3c4c(C(N)=O)cccc4n(Cc4ccc(C(N)=O)cc4)c3c2)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-34-21-12-9-18(10-13-21)20-11-14-22-25(15-20)31(16-17-5-7-19(8-6-17)27(29)32)24-4-2-3-23(26(22)24)28(30)33/h2-15H,16H2,1H3,(H2,29,32)(H2,30,33) |
| InChIKey | OEMQATZSFIXPGD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |