C25H22F2N2O6 — CID 151981594
2-[5-carbamoyl-9-[[3-(difluoromethoxy)phenyl]methyl]-2-ethylcarbazol-4-yl]peroxyacetic acid (PubChem CID 151981594) has the molecular formula C25H22F2N2O6 and a molecular weight of 484.46 g/mol. Its IUPAC name is 2-[5-carbamoyl-9-[[3-(difluoromethoxy)phenyl]methyl]-2-ethylcarbazol-4-yl]peroxyacetic acid.
| Compound Name | 2-[5-carbamoyl-9-[[3-(difluoromethoxy)phenyl]methyl]-2-ethylcarbazol-4-yl]peroxyacetic acid |
|---|---|
| PubChem CID | 151981594 |
| Molecular Formula | C25H22F2N2O6 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[5-carbamoyl-9-[[3-(difluoromethoxy)phenyl]methyl]-2-ethylcarbazol-4-yl]peroxyacetic acid |
| SMILES | CCc1cc(OOCC(=O)O)c2c3c(C(N)=O)cccc3n(Cc3cccc(OC(F)F)c3)c2c1 |
| InChI | InChI=1S/C25H22F2N2O6/c1-2-14-10-19-23(20(11-14)35-33-13-21(30)31)22-17(24(28)32)7-4-8-18(22)29(19)12-15-5-3-6-16(9-15)34-25(26)27/h3-11,25H,2,12-13H2,1H3,(H2,28,32)(H,30,31) |
| InChIKey | UCUFZZMOXPRRKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|