C26H22F4N2O5 — CID 151706582
2-[5-carbamoyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-propylcarbazol-4-yl]peroxyacetic acid (PubChem CID 151706582) has the molecular formula C26H22F4N2O5 and a molecular weight of 518.46 g/mol. Its IUPAC name is 2-[5-carbamoyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-propylcarbazol-4-yl]peroxyacetic acid.
| Compound Name | 2-[5-carbamoyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-propylcarbazol-4-yl]peroxyacetic acid |
|---|---|
| PubChem CID | 151706582 |
| Molecular Formula | C26H22F4N2O5 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-[5-carbamoyl-9-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-propylcarbazol-4-yl]peroxyacetic acid |
| SMILES | CCCc1cc(OOCC(=O)O)c2c3c(C(N)=O)cccc3n(Cc3ccc(F)c(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C26H22F4N2O5/c1-2-4-14-10-20-24(21(11-14)37-36-13-22(33)34)23-16(25(31)35)5-3-6-19(23)32(20)12-15-7-8-18(27)17(9-15)26(28,29)30/h3,5-11H,2,4,12-13H2,1H3,(H2,31,35)(H,33,34) |
| InChIKey | RFSBYJBWSAYLMW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|