C23H16ClF3N2O5 — CID 151349346
2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetic acid (PubChem CID 151349346) has the molecular formula C23H16ClF3N2O5 and a molecular weight of 492.84 g/mol. Its IUPAC name is 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetic acid.
| Compound Name | 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetic acid |
|---|---|
| PubChem CID | 151349346 |
| Molecular Formula | C23H16ClF3N2O5 |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetic acid |
| SMILES | NC(=O)c1cccc2c1c1c(OOCC(=O)O)ccc(Cl)c1n2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H16ClF3N2O5/c24-15-8-9-17(34-33-11-18(30)31)20-19-13(22(28)32)5-3-7-16(19)29(21(15)20)10-12-4-1-2-6-14(12)23(25,26)27/h1-9H,10-11H2,(H2,28,32)(H,30,31) |
| InChIKey | OMDNCHHBZAJBCB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|