C24H18ClF3N2O5 — CID 151305881
methyl 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetate (PubChem CID 151305881) has the molecular formula C24H18ClF3N2O5 and a molecular weight of 506.86 g/mol. Its IUPAC name is methyl 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetate.
| Compound Name | methyl 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetate |
|---|---|
| PubChem CID | 151305881 |
| Molecular Formula | C24H18ClF3N2O5 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | methyl 2-[5-carbamoyl-1-chloro-9-[[2-(trifluoromethyl)phenyl]methyl]carbazol-4-yl]peroxyacetate |
| SMILES | COC(=O)COOc1ccc(Cl)c2c1c1c(C(N)=O)cccc1n2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H18ClF3N2O5/c1-33-19(31)12-34-35-18-10-9-16(25)22-21(18)20-14(23(29)32)6-4-8-17(20)30(22)11-13-5-2-3-7-15(13)24(26,27)28/h2-10H,11-12H2,1H3,(H2,29,32) |
| InChIKey | ODJYHWQSOKDZJJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|