C23H20N2O4 — CID 91121386
[5-carbamoyl-9-[(2-methylphenyl)methyl]carbazol-4-yl] 2-hydroxyacetate (PubChem CID 91121386) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is [5-carbamoyl-9-[(2-methylphenyl)methyl]carbazol-4-yl] 2-hydroxyacetate.
| Compound Name | [5-carbamoyl-9-[(2-methylphenyl)methyl]carbazol-4-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 91121386 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [5-carbamoyl-9-[(2-methylphenyl)methyl]carbazol-4-yl] 2-hydroxyacetate |
| SMILES | Cc1ccccc1Cn1c2cccc(OC(=O)CO)c2c2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C23H20N2O4/c1-14-6-2-3-7-15(14)12-25-17-9-4-8-16(23(24)28)21(17)22-18(25)10-5-11-19(22)29-20(27)13-26/h2-11,26H,12-13H2,1H3,(H2,24,28) |
| InChIKey | DKEJTJBSWURAMR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|